C25H30FN3O5 — CID 162357037
7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2,3-diamino-2-methylpropanoate (PubChem CID 162357037) has the molecular formula C25H30FN3O5 and a molecular weight of 471.53 g/mol. Its IUPAC name is 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2,3-diamino-2-methylpropanoate.
| Compound Name | 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2,3-diamino-2-methylpropanoate |
|---|---|
| PubChem CID | 162357037 |
| Molecular Formula | C25H30FN3O5 |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2,3-diamino-2-methylpropanoate |
| SMILES | CC(N)(CN)C(=O)OCCCCCCCn1cc2cc(-c3cccc(F)c3)c(=O)oc2cc1=O |
| InChI | InChI=1S/C25H30FN3O5/c1-25(28,16-27)24(32)33-11-6-4-2-3-5-10-29-15-18-13-20(17-8-7-9-19(26)12-17)23(31)34-21(18)14-22(29)30/h7-9,12-15H,2-6,10-11,16,27-28H2,1H3 |
| InChIKey | UULDYJYJVYIDNM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 130.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|