C35H46F3NO5 — CID 162357011
9-[2-oxo-3-[4-(trifluoromethyl)phenyl]pyrano[2,3-c]pyridin-8-yl]oxynonyl 2,2,3,5,5-pentamethylhexanoate (PubChem CID 162357011) has the molecular formula C35H46F3NO5 and a molecular weight of 617.75 g/mol. Its IUPAC name is 9-[2-oxo-3-[4-(trifluoromethyl)phenyl]pyrano[2,3-c]pyridin-8-yl]oxynonyl 2,2,3,5,5-pentamethylhexanoate.
| Compound Name | 9-[2-oxo-3-[4-(trifluoromethyl)phenyl]pyrano[2,3-c]pyridin-8-yl]oxynonyl 2,2,3,5,5-pentamethylhexanoate |
|---|---|
| PubChem CID | 162357011 |
| Molecular Formula | C35H46F3NO5 |
| Molecular Weight | 617.75 g/mol |
| Exact Mass | 617.33 |
| IUPAC Name | 9-[2-oxo-3-[4-(trifluoromethyl)phenyl]pyrano[2,3-c]pyridin-8-yl]oxynonyl 2,2,3,5,5-pentamethylhexanoate |
| SMILES | CC(CC(C)(C)C)C(C)(C)C(=O)OCCCCCCCCCOc1nccc2cc(-c3ccc(C(F)(F)F)cc3)c(=O)oc12 |
| InChI | InChI=1S/C35H46F3NO5/c1-24(23-33(2,3)4)34(5,6)32(41)43-21-13-11-9-7-8-10-12-20-42-30-29-26(18-19-39-30)22-28(31(40)44-29)25-14-16-27(17-15-25)35(36,37)38/h14-19,22,24H,7-13,20-21,23H2,1-6H3 |
| InChIKey | IHMLXDBTRLIZQA-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.75 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|