C15H9FO4 — CID 154947609
3-(3-fluorophenyl)-7,8-dihydroxychromen-2-one (PubChem CID 154947609) has the molecular formula C15H9FO4 and a molecular weight of 272.23 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-7,8-dihydroxychromen-2-one.
| Compound Name | 3-(3-fluorophenyl)-7,8-dihydroxychromen-2-one |
|---|---|
| PubChem CID | 154947609 |
| Molecular Formula | C15H9FO4 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 3-(3-fluorophenyl)-7,8-dihydroxychromen-2-one |
| SMILES | O=c1oc2c(O)c(O)ccc2cc1-c1cccc(F)c1 |
| InChI | InChI=1S/C15H9FO4/c16-10-3-1-2-8(6-10)11-7-9-4-5-12(17)13(18)14(9)20-15(11)19/h1-7,17-18H |
| InChIKey | AYGHGYMOPLORRC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|