C23H26O5 — CID 10022785
3-(3,5-ditert-butyl-2-hydroxyphenyl)-7,8-dihydroxychromen-2-one (PubChem CID 10022785) has the molecular formula C23H26O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-2-hydroxyphenyl)-7,8-dihydroxychromen-2-one.
| Compound Name | 3-(3,5-ditert-butyl-2-hydroxyphenyl)-7,8-dihydroxychromen-2-one |
|---|---|
| PubChem CID | 10022785 |
| Molecular Formula | C23H26O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 3-(3,5-ditert-butyl-2-hydroxyphenyl)-7,8-dihydroxychromen-2-one |
| SMILES | CC(C)(C)c1cc(-c2cc3ccc(O)c(O)c3oc2=O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H26O5/c1-22(2,3)13-10-14(18(25)16(11-13)23(4,5)6)15-9-12-7-8-17(24)19(26)20(12)28-21(15)27/h7-11,24-26H,1-6H3 |
| InChIKey | YCRLFRKJBSNTMT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|