C14H9NO5 — CID 134911870
6,7,8-trihydroxy-3-pyridin-3-ylchromen-2-one (PubChem CID 134911870) has the molecular formula C14H9NO5 and a molecular weight of 271.23 g/mol. Its IUPAC name is 6,7,8-trihydroxy-3-pyridin-3-ylchromen-2-one.
| Compound Name | 6,7,8-trihydroxy-3-pyridin-3-ylchromen-2-one |
|---|---|
| PubChem CID | 134911870 |
| Molecular Formula | C14H9NO5 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 6,7,8-trihydroxy-3-pyridin-3-ylchromen-2-one |
| SMILES | O=c1oc2c(O)c(O)c(O)cc2cc1-c1cccnc1 |
| InChI | InChI=1S/C14H9NO5/c16-10-5-8-4-9(7-2-1-3-15-6-7)14(19)20-13(8)12(18)11(10)17/h1-6,16-18H |
| InChIKey | OLEXYVYJWQAVAD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|