C13H9N3O — CID 23156672
2-pyridin-3-yl-1,6-naphthyridin-3-ol (PubChem CID 23156672) has the molecular formula C13H9N3O and a molecular weight of 223.24 g/mol. Its IUPAC name is 2-pyridin-3-yl-1,6-naphthyridin-3-ol.
| Compound Name | 2-pyridin-3-yl-1,6-naphthyridin-3-ol |
|---|---|
| PubChem CID | 23156672 |
| Molecular Formula | C13H9N3O |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 2-pyridin-3-yl-1,6-naphthyridin-3-ol |
| SMILES | Oc1cc2cnccc2nc1-c1cccnc1 |
| InChI | InChI=1S/C13H9N3O/c17-12-6-10-8-15-5-3-11(10)16-13(12)9-2-1-4-14-7-9/h1-8,17H |
| InChIKey | QDCJTFVQRJTMDD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |