C21H14N2O4 — CID 86650366
8-hydroxy-2-oxo-N-(3-pyridin-3-ylphenyl)chromene-3-carboxamide (PubChem CID 86650366) has the molecular formula C21H14N2O4 and a molecular weight of 358.35 g/mol. Its IUPAC name is 8-hydroxy-2-oxo-N-(3-pyridin-3-ylphenyl)chromene-3-carboxamide.
| Compound Name | 8-hydroxy-2-oxo-N-(3-pyridin-3-ylphenyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 86650366 |
| Molecular Formula | C21H14N2O4 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 8-hydroxy-2-oxo-N-(3-pyridin-3-ylphenyl)chromene-3-carboxamide |
| SMILES | O=C(Nc1cccc(-c2cccnc2)c1)c1cc2cccc(O)c2oc1=O |
| InChI | InChI=1S/C21H14N2O4/c24-18-8-2-5-14-11-17(21(26)27-19(14)18)20(25)23-16-7-1-4-13(10-16)15-6-3-9-22-12-15/h1-12,24H,(H,23,25) |
| InChIKey | VNVGTHHZDYZBSM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|