C23H19N3O4 — CID 86650433
N-[3-[6-(dimethylamino)-3-pyridinyl]phenyl]-8-hydroxy-2-oxochromene-3-carboxamide (PubChem CID 86650433) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is N-[3-[6-(dimethylamino)-3-pyridinyl]phenyl]-8-hydroxy-2-oxochromene-3-carboxamide.
| Compound Name | N-[3-[6-(dimethylamino)-3-pyridinyl]phenyl]-8-hydroxy-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 86650433 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-[3-[6-(dimethylamino)-3-pyridinyl]phenyl]-8-hydroxy-2-oxochromene-3-carboxamide |
| SMILES | CN(C)c1ccc(-c2cccc(NC(=O)c3cc4cccc(O)c4oc3=O)c2)cn1 |
| InChI | InChI=1S/C23H19N3O4/c1-26(2)20-10-9-16(13-24-20)14-5-3-7-17(11-14)25-22(28)18-12-15-6-4-8-19(27)21(15)30-23(18)29/h3-13,27H,1-2H3,(H,25,28) |
| InChIKey | CRUDUZRPYOPNIS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|