C26H29NO5 — CID 162356805
7-[3-(2-methylphenyl)-2-oxopyrano[2,3-c]pyridin-6-yl]oxyheptyl 2-methylprop-2-enoate (PubChem CID 162356805) has the molecular formula C26H29NO5 and a molecular weight of 435.52 g/mol. Its IUPAC name is 7-[3-(2-methylphenyl)-2-oxopyrano[2,3-c]pyridin-6-yl]oxyheptyl 2-methylprop-2-enoate.
| Compound Name | 7-[3-(2-methylphenyl)-2-oxopyrano[2,3-c]pyridin-6-yl]oxyheptyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 162356805 |
| Molecular Formula | C26H29NO5 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 7-[3-(2-methylphenyl)-2-oxopyrano[2,3-c]pyridin-6-yl]oxyheptyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCOc1cc2cc(-c3ccccc3C)c(=O)oc2cn1 |
| InChI | InChI=1S/C26H29NO5/c1-18(2)25(28)31-14-10-6-4-5-9-13-30-24-16-20-15-22(21-12-8-7-11-19(21)3)26(29)32-23(20)17-27-24/h7-8,11-12,15-17H,1,4-6,9-10,13-14H2,2-3H3 |
| InChIKey | RNFLKYUHJSUZPN-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|