C21H16Cl3N3O3 — CID 142576016
3-[8-chloro-4-(2,6-dichloro-3,5-dimethoxyphenyl)imidazo[1,2-a][1,6]naphthyridin-2-yl]propanal (PubChem CID 142576016) has the molecular formula C21H16Cl3N3O3 and a molecular weight of 464.74 g/mol. Its IUPAC name is 3-[8-chloro-4-(2,6-dichloro-3,5-dimethoxyphenyl)imidazo[1,2-a][1,6]naphthyridin-2-yl]propanal.
| Compound Name | 3-[8-chloro-4-(2,6-dichloro-3,5-dimethoxyphenyl)imidazo[1,2-a][1,6]naphthyridin-2-yl]propanal |
|---|---|
| PubChem CID | 142576016 |
| Molecular Formula | C21H16Cl3N3O3 |
| Molecular Weight | 464.74 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | 3-[8-chloro-4-(2,6-dichloro-3,5-dimethoxyphenyl)imidazo[1,2-a][1,6]naphthyridin-2-yl]propanal |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3cnc(Cl)cc3n3cc(CCC=O)nc23)c1Cl |
| InChI | InChI=1S/C21H16Cl3N3O3/c1-29-15-8-16(30-2)20(24)18(19(15)23)13-6-11-9-25-17(22)7-14(11)27-10-12(4-3-5-28)26-21(13)27/h5-10H,3-4H2,1-2H3 |
| InChIKey | MGCMZQHIQCBQLZ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.74 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|