C14H12ClF2NO3 — CID 122604606
2-chloro-5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]pyridine (PubChem CID 122604606) has the molecular formula C14H12ClF2NO3 and a molecular weight of 315.70 g/mol. Its IUPAC name is 2-chloro-5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]pyridine.
| Compound Name | 2-chloro-5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]pyridine |
|---|---|
| PubChem CID | 122604606 |
| Molecular Formula | C14H12ClF2NO3 |
| Molecular Weight | 315.70 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 2-chloro-5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]pyridine |
| SMILES | COc1cc(OC)c(F)c(COc2ccc(Cl)nc2)c1F |
| InChI | InChI=1S/C14H12ClF2NO3/c1-19-10-5-11(20-2)14(17)9(13(10)16)7-21-8-3-4-12(15)18-6-8/h3-6H,7H2,1-2H3 |
| InChIKey | INZFKMIRDYRESI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.70 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|