C13H12F2N2O3 — CID 141433703
5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]pyrimidine (PubChem CID 141433703) has the molecular formula C13H12F2N2O3 and a molecular weight of 282.25 g/mol. Its IUPAC name is 5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]pyrimidine.
| Compound Name | 5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]pyrimidine |
|---|---|
| PubChem CID | 141433703 |
| Molecular Formula | C13H12F2N2O3 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]pyrimidine |
| SMILES | COc1cc(OC)c(F)c(COc2cncnc2)c1F |
| InChI | InChI=1S/C13H12F2N2O3/c1-18-10-3-11(19-2)13(15)9(12(10)14)6-20-8-4-16-7-17-5-8/h3-5,7H,6H2,1-2H3 |
| InChIKey | ASJQOAFPRHBZNS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |