C11H8F2N2O — CID 175928368
5-[(3,5-difluorophenyl)methoxy]pyrimidine (PubChem CID 175928368) has the molecular formula C11H8F2N2O and a molecular weight of 222.19 g/mol. Its IUPAC name is 5-[(3,5-difluorophenyl)methoxy]pyrimidine.
| Compound Name | 5-[(3,5-difluorophenyl)methoxy]pyrimidine |
|---|---|
| PubChem CID | 175928368 |
| Molecular Formula | C11H8F2N2O |
| Molecular Weight | 222.19 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 5-[(3,5-difluorophenyl)methoxy]pyrimidine |
| SMILES | Fc1cc(F)cc(COc2cncnc2)c1 |
| InChI | InChI=1S/C11H8F2N2O/c12-9-1-8(2-10(13)3-9)6-16-11-4-14-7-15-5-11/h1-5,7H,6H2 |
| InChIKey | GCOFKEPIWPCUET-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.19 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |