C18H14F2N2O2 — CID 139794421
6-[4-[(3,5-difluorophenyl)methoxy]phenoxy]pyridin-3-amine (PubChem CID 139794421) has the molecular formula C18H14F2N2O2 and a molecular weight of 328.32 g/mol. Its IUPAC name is 6-[4-[(3,5-difluorophenyl)methoxy]phenoxy]pyridin-3-amine.
| Compound Name | 6-[4-[(3,5-difluorophenyl)methoxy]phenoxy]pyridin-3-amine |
|---|---|
| PubChem CID | 139794421 |
| Molecular Formula | C18H14F2N2O2 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 6-[4-[(3,5-difluorophenyl)methoxy]phenoxy]pyridin-3-amine |
| SMILES | Nc1ccc(Oc2ccc(OCc3cc(F)cc(F)c3)cc2)nc1 |
| InChI | InChI=1S/C18H14F2N2O2/c19-13-7-12(8-14(20)9-13)11-23-16-2-4-17(5-3-16)24-18-6-1-15(21)10-22-18/h1-10H,11,21H2 |
| InChIKey | UNJKELCONXQBND-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_A(8)', 'substructure': 'N/A'} |
|---|