C19H14F2IO+ — CID 167331521
[4-[(3,5-difluorophenyl)methoxy]phenyl]-phenyliodanium (PubChem CID 167331521) has the molecular formula C19H14F2IO+ and a molecular weight of 423.22 g/mol. Its IUPAC name is [4-[(3,5-difluorophenyl)methoxy]phenyl]-phenyliodanium.
| Compound Name | [4-[(3,5-difluorophenyl)methoxy]phenyl]-phenyliodanium |
|---|---|
| PubChem CID | 167331521 |
| Molecular Formula | C19H14F2IO+ |
| Molecular Weight | 423.22 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | [4-[(3,5-difluorophenyl)methoxy]phenyl]-phenyliodanium |
| SMILES | Fc1cc(F)cc(COc2ccc([I+]c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C19H14F2IO/c20-15-10-14(11-16(21)12-15)13-23-19-8-6-18(7-9-19)22-17-4-2-1-3-5-17/h1-12H,13H2/q+1 |
| InChIKey | JYXIJEAGRVDAQZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.22 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|