C15H14F2O — CID 105409859
1-[(3-ethylphenoxy)methyl]-3,5-difluorobenzene (PubChem CID 105409859) has the molecular formula C15H14F2O and a molecular weight of 248.27 g/mol. Its IUPAC name is 1-[(3-ethylphenoxy)methyl]-3,5-difluorobenzene.
| Compound Name | 1-[(3-ethylphenoxy)methyl]-3,5-difluorobenzene |
|---|---|
| PubChem CID | 105409859 |
| Molecular Formula | C15H14F2O |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 1-[(3-ethylphenoxy)methyl]-3,5-difluorobenzene |
| SMILES | CCc1cccc(OCc2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C15H14F2O/c1-2-11-4-3-5-15(8-11)18-10-12-6-13(16)9-14(17)7-12/h3-9H,2,10H2,1H3 |
| InChIKey | RKVGWVIEMCZUCP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |