C20H17F2NO — CID 46044362
3-(3,5-difluorophenyl)-5-[(3-ethylphenoxy)methyl]pyridine (PubChem CID 46044362) has the molecular formula C20H17F2NO and a molecular weight of 325.36 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-5-[(3-ethylphenoxy)methyl]pyridine.
| Compound Name | 3-(3,5-difluorophenyl)-5-[(3-ethylphenoxy)methyl]pyridine |
|---|---|
| PubChem CID | 46044362 |
| Molecular Formula | C20H17F2NO |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 3-(3,5-difluorophenyl)-5-[(3-ethylphenoxy)methyl]pyridine |
| SMILES | CCc1cccc(OCc2cncc(-c3cc(F)cc(F)c3)c2)c1 |
| InChI | InChI=1S/C20H17F2NO/c1-2-14-4-3-5-20(7-14)24-13-15-6-17(12-23-11-15)16-8-18(21)10-19(22)9-16/h3-12H,2,13H2,1H3 |
| InChIKey | UEVFSPBNEOBKNS-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |