C20H19NO — CID 46044387
3-(3,5-dimethylphenyl)-5-(phenoxymethyl)pyridine (PubChem CID 46044387) has the molecular formula C20H19NO and a molecular weight of 289.38 g/mol. Its IUPAC name is 3-(3,5-dimethylphenyl)-5-(phenoxymethyl)pyridine.
| Compound Name | 3-(3,5-dimethylphenyl)-5-(phenoxymethyl)pyridine |
|---|---|
| PubChem CID | 46044387 |
| Molecular Formula | C20H19NO |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 3-(3,5-dimethylphenyl)-5-(phenoxymethyl)pyridine |
| SMILES | Cc1cc(C)cc(-c2cncc(COc3ccccc3)c2)c1 |
| InChI | InChI=1S/C20H19NO/c1-15-8-16(2)10-18(9-15)19-11-17(12-21-13-19)14-22-20-6-4-3-5-7-20/h3-13H,14H2,1-2H3 |
| InChIKey | HGAQXPXGGFJCDH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |