C22H23NO2 — CID 42851644
3-[(2,4-dimethylphenoxy)methyl]-5-(3-ethoxyphenyl)pyridine (PubChem CID 42851644) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is 3-[(2,4-dimethylphenoxy)methyl]-5-(3-ethoxyphenyl)pyridine.
| Compound Name | 3-[(2,4-dimethylphenoxy)methyl]-5-(3-ethoxyphenyl)pyridine |
|---|---|
| PubChem CID | 42851644 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 3-[(2,4-dimethylphenoxy)methyl]-5-(3-ethoxyphenyl)pyridine |
| SMILES | CCOc1cccc(-c2cncc(COc3ccc(C)cc3C)c2)c1 |
| InChI | InChI=1S/C22H23NO2/c1-4-24-21-7-5-6-19(12-21)20-11-18(13-23-14-20)15-25-22-9-8-16(2)10-17(22)3/h5-14H,4,15H2,1-3H3 |
| InChIKey | ZZFLXUSNLSGJJP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |