C19H15Cl2NO — CID 42851689
3-(3,4-dichlorophenyl)-5-[(2-methylphenoxy)methyl]pyridine (PubChem CID 42851689) has the molecular formula C19H15Cl2NO and a molecular weight of 344.24 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-5-[(2-methylphenoxy)methyl]pyridine.
| Compound Name | 3-(3,4-dichlorophenyl)-5-[(2-methylphenoxy)methyl]pyridine |
|---|---|
| PubChem CID | 42851689 |
| Molecular Formula | C19H15Cl2NO |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-5-[(2-methylphenoxy)methyl]pyridine |
| SMILES | Cc1ccccc1OCc1cncc(-c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C19H15Cl2NO/c1-13-4-2-3-5-19(13)23-12-14-8-16(11-22-10-14)15-6-7-17(20)18(21)9-15/h2-11H,12H2,1H3 |
| InChIKey | DXDLXZGBVQJNKK-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |