C13H7ClF2N2O — CID 88919533
2-chloro-5-[(3,5-difluorophenyl)methoxy]pyridine-3-carbonitrile (PubChem CID 88919533) has the molecular formula C13H7ClF2N2O and a molecular weight of 280.66 g/mol. Its IUPAC name is 2-chloro-5-[(3,5-difluorophenyl)methoxy]pyridine-3-carbonitrile.
| Compound Name | 2-chloro-5-[(3,5-difluorophenyl)methoxy]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 88919533 |
| Molecular Formula | C13H7ClF2N2O |
| Molecular Weight | 280.66 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | 2-chloro-5-[(3,5-difluorophenyl)methoxy]pyridine-3-carbonitrile |
| SMILES | N#Cc1cc(OCc2cc(F)cc(F)c2)cnc1Cl |
| InChI | InChI=1S/C13H7ClF2N2O/c14-13-9(5-17)3-12(6-18-13)19-7-8-1-10(15)4-11(16)2-8/h1-4,6H,7H2 |
| InChIKey | PLERTPJDYXYVTI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.66 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|