C13H14F2N4 — CID 170331623
1-(4,4-difluoropiperidin-1-yl)-2,7-naphthyridin-3-amine (PubChem CID 170331623) has the molecular formula C13H14F2N4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 1-(4,4-difluoropiperidin-1-yl)-2,7-naphthyridin-3-amine.
| Compound Name | 1-(4,4-difluoropiperidin-1-yl)-2,7-naphthyridin-3-amine |
|---|---|
| PubChem CID | 170331623 |
| Molecular Formula | C13H14F2N4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1-(4,4-difluoropiperidin-1-yl)-2,7-naphthyridin-3-amine |
| SMILES | Nc1cc2ccncc2c(N2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C13H14F2N4/c14-13(15)2-5-19(6-3-13)12-10-8-17-4-1-9(10)7-11(16)18-12/h1,4,7-8H,2-3,5-6H2,(H2,16,18) |
| InChIKey | BTEJDPRYLVYEDZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |