C14H15F2N3 — CID 170328485
8-(4,4-difluoropiperidin-1-yl)quinolin-6-amine (PubChem CID 170328485) has the molecular formula C14H15F2N3 and a molecular weight of 263.29 g/mol. Its IUPAC name is 8-(4,4-difluoropiperidin-1-yl)quinolin-6-amine.
| Compound Name | 8-(4,4-difluoropiperidin-1-yl)quinolin-6-amine |
|---|---|
| PubChem CID | 170328485 |
| Molecular Formula | C14H15F2N3 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 8-(4,4-difluoropiperidin-1-yl)quinolin-6-amine |
| SMILES | Nc1cc(N2CCC(F)(F)CC2)c2ncccc2c1 |
| InChI | InChI=1S/C14H15F2N3/c15-14(16)3-6-19(7-4-14)12-9-11(17)8-10-2-1-5-18-13(10)12/h1-2,5,8-9H,3-4,6-7,17H2 |
| InChIKey | YKNNQUUFEJIOSW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|