C22H19F4N3O2 — CID 177282887
6-[(1Z,3Z,5E)-2,4-difluoro-6-nitroocta-1,3,5,7-tetraenyl]-8-(4,4-difluoropiperidin-1-yl)quinoline (PubChem CID 177282887) has the molecular formula C22H19F4N3O2 and a molecular weight of 433.41 g/mol. Its IUPAC name is 6-[(1Z,3Z,5E)-2,4-difluoro-6-nitroocta-1,3,5,7-tetraenyl]-8-(4,4-difluoropiperidin-1-yl)quinoline.
| Compound Name | 6-[(1Z,3Z,5E)-2,4-difluoro-6-nitroocta-1,3,5,7-tetraenyl]-8-(4,4-difluoropiperidin-1-yl)quinoline |
|---|---|
| PubChem CID | 177282887 |
| Molecular Formula | C22H19F4N3O2 |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 6-[(1Z,3Z,5E)-2,4-difluoro-6-nitroocta-1,3,5,7-tetraenyl]-8-(4,4-difluoropiperidin-1-yl)quinoline |
| SMILES | C=C/C(=C\C(F)=C\C(F)=C\c1cc(N2CCC(F)(F)CC2)c2ncccc2c1)[N+](=O)[O-] |
| InChI | InChI=1S/C22H19F4N3O2/c1-2-19(29(30)31)14-18(24)13-17(23)11-15-10-16-4-3-7-27-21(16)20(12-15)28-8-5-22(25,26)6-9-28/h2-4,7,10-14H,1,5-6,8-9H2/b17-11-,18-13-,19-14+ |
| InChIKey | MZGJLUMJSZHBGX-CZYBRWCGSA-N |
| XLogP | 5.98 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|