C15H14F2N2O — CID 170328398
8-(4,4-difluoropiperidin-1-yl)quinoline-6-carbaldehyde (PubChem CID 170328398) has the molecular formula C15H14F2N2O and a molecular weight of 276.29 g/mol. Its IUPAC name is 8-(4,4-difluoropiperidin-1-yl)quinoline-6-carbaldehyde.
| Compound Name | 8-(4,4-difluoropiperidin-1-yl)quinoline-6-carbaldehyde |
|---|---|
| PubChem CID | 170328398 |
| Molecular Formula | C15H14F2N2O |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 8-(4,4-difluoropiperidin-1-yl)quinoline-6-carbaldehyde |
| SMILES | O=Cc1cc(N2CCC(F)(F)CC2)c2ncccc2c1 |
| InChI | InChI=1S/C15H14F2N2O/c16-15(17)3-6-19(7-4-15)13-9-11(10-20)8-12-2-1-5-18-14(12)13/h1-2,5,8-10H,3-4,6-7H2 |
| InChIKey | YOGFEGMEGOTZCE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|