C11H7NO2 — CID 119087265
quinoline-6,8-dicarbaldehyde (PubChem CID 119087265) has the molecular formula C11H7NO2 and a molecular weight of 185.18 g/mol. Its IUPAC name is quinoline-6,8-dicarbaldehyde.
| Compound Name | quinoline-6,8-dicarbaldehyde |
|---|---|
| PubChem CID | 119087265 |
| Molecular Formula | C11H7NO2 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | quinoline-6,8-dicarbaldehyde |
| SMILES | O=Cc1cc(C=O)c2ncccc2c1 |
| InChI | InChI=1S/C11H7NO2/c13-6-8-4-9-2-1-3-12-11(9)10(5-8)7-14/h1-7H |
| InChIKey | CTTNNTOLRHRQTA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|