About 3-ethenyl-1,10-phenanthroline
3-ethenyl-1,10-phenanthroline (PubChem CID 58813469) has the molecular formula C14H10N2
and a molecular weight of 206.25 g/mol. Its IUPAC name is 3-ethenyl-1,10-phenanthroline.
Molecular Properties
| Compound Name | 3-ethenyl-1,10-phenanthroline |
| PubChem CID | 58813469 |
| Molecular Formula | C14H10N2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 3-ethenyl-1,10-phenanthroline |
| SMILES | C=Cc1cnc2c(ccc3cccnc32)c1 |
| InChI | InChI=1S/C14H10N2/c1-2-10-8-12-6-5-11-4-3-7-15-13(11)14(12)16-9-10/h2-9H,1H2 |
| InChIKey | HOTBNSHVUMLZOW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenyl-1,10-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-1,10-phenanthroline?
The IUPAC name of 3-ethenyl-1,10-phenanthroline (CID 58813469) is 3-ethenyl-1,10-phenanthroline.
What is the SMILES notation for 3-ethenyl-1,10-phenanthroline?
The canonical SMILES for 3-ethenyl-1,10-phenanthroline is C=Cc1cnc2c(ccc3cccnc32)c1.
What is the InChIKey of 3-ethenyl-1,10-phenanthroline?
The InChIKey is HOTBNSHVUMLZOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2/c1-2-10-8-12-6-5-11-4-3-7-15-13(11)14(12)16-9-10/h2-9H,1H2.
What are the key properties of 3-ethenyl-1,10-phenanthroline?
3-ethenyl-1,10-phenanthroline has a molecular weight of 206.25 g/mol, XLogP of 3.43, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-1,10-phenanthroline is sourced from PubChem (CID 58813469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).