About 3-bromo-1,10-phenanthroline;ruthenium
3-bromo-1,10-phenanthroline;ruthenium (PubChem CID 59061228) has the molecular formula C12H7BrN2Ru
and a molecular weight of 360.18 g/mol. Its IUPAC name is 3-bromo-1,10-phenanthroline;ruthenium.
Molecular Properties
| Compound Name | 3-bromo-1,10-phenanthroline;ruthenium |
| PubChem CID | 59061228 |
| Molecular Formula | C12H7BrN2Ru |
| Molecular Weight | 360.18 g/mol |
| Exact Mass | 359.88 |
| IUPAC Name | 3-bromo-1,10-phenanthroline;ruthenium |
| SMILES | Brc1cnc2c(ccc3cccnc32)c1.[Ru] |
| InChI | InChI=1S/C12H7BrN2.Ru/c13-10-6-9-4-3-8-2-1-5-14-11(8)12(9)15-7-10;/h1-7H; |
| InChIKey | NCRKQNSSQJHOMP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.18 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-1,10-phenanthroline;ruthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1,10-phenanthroline;ruthenium?
The IUPAC name of 3-bromo-1,10-phenanthroline;ruthenium (CID 59061228) is 3-bromo-1,10-phenanthroline;ruthenium.
What is the SMILES notation for 3-bromo-1,10-phenanthroline;ruthenium?
The canonical SMILES for 3-bromo-1,10-phenanthroline;ruthenium is Brc1cnc2c(ccc3cccnc32)c1.[Ru].
What is the InChIKey of 3-bromo-1,10-phenanthroline;ruthenium?
The InChIKey is NCRKQNSSQJHOMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7BrN2.Ru/c13-10-6-9-4-3-8-2-1-5-14-11(8)12(9)15-7-10;/h1-7H;.
What are the key properties of 3-bromo-1,10-phenanthroline;ruthenium?
3-bromo-1,10-phenanthroline;ruthenium has a molecular weight of 360.18 g/mol, XLogP of 3.54, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1,10-phenanthroline;ruthenium is sourced from PubChem (CID 59061228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).