About 9-bromo-1,7-phenanthroline
9-bromo-1,7-phenanthroline (PubChem CID 59412924) has the molecular formula C12H7BrN2
and a molecular weight of 259.11 g/mol. Its IUPAC name is 9-bromo-1,7-phenanthroline.
Molecular Properties
| Compound Name | 9-bromo-1,7-phenanthroline |
| PubChem CID | 59412924 |
| Molecular Formula | C12H7BrN2 |
| Molecular Weight | 259.11 g/mol |
| Exact Mass | 257.98 |
| IUPAC Name | 9-bromo-1,7-phenanthroline |
| SMILES | Brc1cnc2ccc3cccnc3c2c1 |
| InChI | InChI=1S/C12H7BrN2/c13-9-6-10-11(15-7-9)4-3-8-2-1-5-14-12(8)10/h1-7H |
| InChIKey | RCWHNMNMCZXMOR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.11 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 9-bromo-1,7-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromo-1,7-phenanthroline?
The IUPAC name of 9-bromo-1,7-phenanthroline (CID 59412924) is 9-bromo-1,7-phenanthroline.
What is the SMILES notation for 9-bromo-1,7-phenanthroline?
The canonical SMILES for 9-bromo-1,7-phenanthroline is Brc1cnc2ccc3cccnc3c2c1.
What is the InChIKey of 9-bromo-1,7-phenanthroline?
The InChIKey is RCWHNMNMCZXMOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7BrN2/c13-9-6-10-11(15-7-9)4-3-8-2-1-5-14-12(8)10/h1-7H.
What are the key properties of 9-bromo-1,7-phenanthroline?
9-bromo-1,7-phenanthroline has a molecular weight of 259.11 g/mol, XLogP of 3.55, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromo-1,7-phenanthroline is sourced from PubChem (CID 59412924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).