C16H16N2 — CID 174169966
3-(2-methylpropyl)-1,10-phenanthroline (PubChem CID 174169966) has the molecular formula C16H16N2 and a molecular weight of 236.32 g/mol. Its IUPAC name is 3-(2-methylpropyl)-1,10-phenanthroline.
| Compound Name | 3-(2-methylpropyl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 174169966 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 3-(2-methylpropyl)-1,10-phenanthroline |
| SMILES | CC(C)Cc1cnc2c(ccc3cccnc32)c1 |
| InChI | InChI=1S/C16H16N2/c1-11(2)8-12-9-14-6-5-13-4-3-7-17-15(13)16(14)18-10-12/h3-7,9-11H,8H2,1-2H3 |
| InChIKey | PNAGLKFUEOPOMN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|