C16H20N4Pt+2 — CID 59769200
(2S,3S)-butane-2,3-diamine;1,10-phenanthroline;platinum(2+) (PubChem CID 59769200) has the molecular formula C16H20N4Pt+2 and a molecular weight of 463.44 g/mol. Its IUPAC name is (2S,3S)-butane-2,3-diamine;1,10-phenanthroline;platinum(2+).
| Compound Name | (2S,3S)-butane-2,3-diamine;1,10-phenanthroline;platinum(2+) |
|---|---|
| PubChem CID | 59769200 |
| Molecular Formula | C16H20N4Pt+2 |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | (2S,3S)-butane-2,3-diamine;1,10-phenanthroline;platinum(2+) |
| SMILES | C[C@H](N)[C@H](C)N.[Pt+2].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.C4H12N2.Pt/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;1-3(5)4(2)6;/h1-8H;3-4H,5-6H2,1-2H3;/q;;+2/t;3-,4-;/m.0./s1 |
| InChIKey | VVKJTOJIXUCZLS-BJGYQJCBSA-N |
| XLogP | 2.46 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|