C13H10N2O3S — CID 175906264
1,10-phenanthrolin-3-ylmethanesulfonic acid (PubChem CID 175906264) has the molecular formula C13H10N2O3S and a molecular weight of 274.30 g/mol. Its IUPAC name is 1,10-phenanthrolin-3-ylmethanesulfonic acid.
| Compound Name | 1,10-phenanthrolin-3-ylmethanesulfonic acid |
|---|---|
| PubChem CID | 175906264 |
| Molecular Formula | C13H10N2O3S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 1,10-phenanthrolin-3-ylmethanesulfonic acid |
| SMILES | O=S(=O)(O)Cc1cnc2c(ccc3cccnc32)c1 |
| InChI | InChI=1S/C13H10N2O3S/c16-19(17,18)8-9-6-11-4-3-10-2-1-5-14-12(10)13(11)15-7-9/h1-7H,8H2,(H,16,17,18) |
| InChIKey | XWZKQERWGDSMKA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|