potassium;quinolin-8-olate;sulfuric acid

C9H8KNO5S — CID 170843806

IUPACpotassium;quinolin-8-olate;sulfuric acid
SMILESO=S(=O)(O)O.[K+].[O-]c1cccc2cccnc12
InChIInChI=1S/C9H7NO.K.H2O4S/c11-8-5-1-3-7-4-2-6-10-9(7)8;;1-5(2,3)4/h1-6,11H;;(H2,1,2,3,4)/q;+1;/p-1
InChIKeyKIKXRVWUVJHGSX-UHFFFAOYSA-M
MW281.33 g/mol
LogP-2.34
Rot. Bonds

About potassium;quinolin-8-olate;sulfuric acid

potassium;quinolin-8-olate;sulfuric acid (PubChem CID 170843806) has the molecular formula C9H8KNO5S and a molecular weight of 281.33 g/mol. Its IUPAC name is potassium;quinolin-8-olate;sulfuric acid.

Molecular Properties

Compound Namepotassium;quinolin-8-olate;sulfuric acid
PubChem CID170843806
Molecular FormulaC9H8KNO5S
Molecular Weight281.33 g/mol
Exact Mass280.98
IUPAC Namepotassium;quinolin-8-olate;sulfuric acid
SMILESO=S(=O)(O)O.[K+].[O-]c1cccc2cccnc12
InChIInChI=1S/C9H7NO.K.H2O4S/c11-8-5-1-3-7-4-2-6-10-9(7)8;;1-5(2,3)4/h1-6,11H;;(H2,1,2,3,4)/q;+1;/p-1
InChIKeyKIKXRVWUVJHGSX-UHFFFAOYSA-M
XLogP-2.34
TPSA110.55 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.33
LogP ≤ 5-2.34
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze potassium;quinolin-8-olate;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium;quinolin-8-olate;sulfuric acid?
The IUPAC name of potassium;quinolin-8-olate;sulfuric acid (CID 170843806) is potassium;quinolin-8-olate;sulfuric acid.
What is the SMILES notation for potassium;quinolin-8-olate;sulfuric acid?
The canonical SMILES for potassium;quinolin-8-olate;sulfuric acid is O=S(=O)(O)O.[K+].[O-]c1cccc2cccnc12.
What is the InChIKey of potassium;quinolin-8-olate;sulfuric acid?
The InChIKey is KIKXRVWUVJHGSX-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H7NO.K.H2O4S/c11-8-5-1-3-7-4-2-6-10-9(7)8;;1-5(2,3)4/h1-6,11H;;(H2,1,2,3,4)/q;+1;/p-1.
What are the key properties of potassium;quinolin-8-olate;sulfuric acid?
potassium;quinolin-8-olate;sulfuric acid has a molecular weight of 281.33 g/mol, XLogP of -2.34, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;quinolin-8-olate;sulfuric acid is sourced from PubChem (CID 170843806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).