About potassium;quinolin-8-olate;sulfuric acid
potassium;quinolin-8-olate;sulfuric acid (PubChem CID 170843806) has the molecular formula C9H8KNO5S
and a molecular weight of 281.33 g/mol. Its IUPAC name is potassium;quinolin-8-olate;sulfuric acid.
Molecular Properties
| Compound Name | potassium;quinolin-8-olate;sulfuric acid |
| PubChem CID | 170843806 |
| Molecular Formula | C9H8KNO5S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 280.98 |
| IUPAC Name | potassium;quinolin-8-olate;sulfuric acid |
| SMILES | O=S(=O)(O)O.[K+].[O-]c1cccc2cccnc12 |
| InChI | InChI=1S/C9H7NO.K.H2O4S/c11-8-5-1-3-7-4-2-6-10-9(7)8;;1-5(2,3)4/h1-6,11H;;(H2,1,2,3,4)/q;+1;/p-1 |
| InChIKey | KIKXRVWUVJHGSX-UHFFFAOYSA-M |
| XLogP | -2.34 |
| TPSA | 110.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze potassium;quinolin-8-olate;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;quinolin-8-olate;sulfuric acid?
The IUPAC name of potassium;quinolin-8-olate;sulfuric acid (CID 170843806) is potassium;quinolin-8-olate;sulfuric acid.
What is the SMILES notation for potassium;quinolin-8-olate;sulfuric acid?
The canonical SMILES for potassium;quinolin-8-olate;sulfuric acid is O=S(=O)(O)O.[K+].[O-]c1cccc2cccnc12.
What is the InChIKey of potassium;quinolin-8-olate;sulfuric acid?
The InChIKey is KIKXRVWUVJHGSX-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H7NO.K.H2O4S/c11-8-5-1-3-7-4-2-6-10-9(7)8;;1-5(2,3)4/h1-6,11H;;(H2,1,2,3,4)/q;+1;/p-1.
What are the key properties of potassium;quinolin-8-olate;sulfuric acid?
potassium;quinolin-8-olate;sulfuric acid has a molecular weight of 281.33 g/mol, XLogP of -2.34, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;quinolin-8-olate;sulfuric acid is sourced from PubChem (CID 170843806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).