About 8-sulfosulfanylquinoline
8-sulfosulfanylquinoline (PubChem CID 175491006) has the molecular formula C9H7NO3S2
and a molecular weight of 241.29 g/mol. Its IUPAC name is 8-sulfosulfanylquinoline.
Molecular Properties
| Compound Name | 8-sulfosulfanylquinoline |
| PubChem CID | 175491006 |
| Molecular Formula | C9H7NO3S2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 240.99 |
| IUPAC Name | 8-sulfosulfanylquinoline |
| SMILES | O=S(=O)(O)Sc1cccc2cccnc12 |
| InChI | InChI=1S/C9H7NO3S2/c11-15(12,13)14-8-5-1-3-7-4-2-6-10-9(7)8/h1-6H,(H,11,12,13) |
| InChIKey | DQGZGBQCLCNPNW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 8-sulfosulfanylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-sulfosulfanylquinoline?
The IUPAC name of 8-sulfosulfanylquinoline (CID 175491006) is 8-sulfosulfanylquinoline.
What is the SMILES notation for 8-sulfosulfanylquinoline?
The canonical SMILES for 8-sulfosulfanylquinoline is O=S(=O)(O)Sc1cccc2cccnc12.
What is the InChIKey of 8-sulfosulfanylquinoline?
The InChIKey is DQGZGBQCLCNPNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO3S2/c11-15(12,13)14-8-5-1-3-7-4-2-6-10-9(7)8/h1-6H,(H,11,12,13).
What are the key properties of 8-sulfosulfanylquinoline?
8-sulfosulfanylquinoline has a molecular weight of 241.29 g/mol, XLogP of 2.13, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-sulfosulfanylquinoline is sourced from PubChem (CID 175491006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).