C12H15F2N3 — CID 156565881
6-(4,4-difluoropiperidin-1-yl)-5-ethenylpyridin-3-amine (PubChem CID 156565881) has the molecular formula C12H15F2N3 and a molecular weight of 239.27 g/mol. Its IUPAC name is 6-(4,4-difluoropiperidin-1-yl)-5-ethenylpyridin-3-amine.
| Compound Name | 6-(4,4-difluoropiperidin-1-yl)-5-ethenylpyridin-3-amine |
|---|---|
| PubChem CID | 156565881 |
| Molecular Formula | C12H15F2N3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 6-(4,4-difluoropiperidin-1-yl)-5-ethenylpyridin-3-amine |
| SMILES | C=Cc1cc(N)cnc1N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H15F2N3/c1-2-9-7-10(15)8-16-11(9)17-5-3-12(13,14)4-6-17/h2,7-8H,1,3-6,15H2 |
| InChIKey | ZQYCRRBSFKEFMZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |