About 2-pyrrolidin-1-ylpyridine-3,5-diamine;hydrate;dihydrochloride
2-pyrrolidin-1-ylpyridine-3,5-diamine;hydrate;dihydrochloride (PubChem CID 21082868) has the molecular formula C9H18Cl2N4O
and a molecular weight of 269.18 g/mol. Its IUPAC name is 2-pyrrolidin-1-ylpyridine-3,5-diamine;hydrate;dihydrochloride.
Molecular Properties
| Compound Name | 2-pyrrolidin-1-ylpyridine-3,5-diamine;hydrate;dihydrochloride |
| PubChem CID | 21082868 |
| Molecular Formula | C9H18Cl2N4O |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 2-pyrrolidin-1-ylpyridine-3,5-diamine;hydrate;dihydrochloride |
| SMILES | Cl.Cl.Nc1cnc(N2CCCC2)c(N)c1.O |
| InChI | InChI=1S/C9H14N4.2ClH.H2O/c10-7-5-8(11)9(12-6-7)13-3-1-2-4-13;;;/h5-6H,1-4,10-11H2;2*1H;1H2 |
| InChIKey | LFAKXEKQHTXZEE-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 99.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-pyrrolidin-1-ylpyridine-3,5-diamine;hydrate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrolidin-1-ylpyridine-3,5-diamine;hydrate;dihydrochloride?
The IUPAC name of 2-pyrrolidin-1-ylpyridine-3,5-diamine;hydrate;dihydrochloride (CID 21082868) is 2-pyrrolidin-1-ylpyridine-3,5-diamine;hydrate;dihydrochloride.
What is the SMILES notation for 2-pyrrolidin-1-ylpyridine-3,5-diamine;hydrate;dihydrochloride?
The canonical SMILES for 2-pyrrolidin-1-ylpyridine-3,5-diamine;hydrate;dihydrochloride is Cl.Cl.Nc1cnc(N2CCCC2)c(N)c1.O.
What is the InChIKey of 2-pyrrolidin-1-ylpyridine-3,5-diamine;hydrate;dihydrochloride?
The InChIKey is LFAKXEKQHTXZEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4.2ClH.H2O/c10-7-5-8(11)9(12-6-7)13-3-1-2-4-13;;;/h5-6H,1-4,10-11H2;2*1H;1H2.
What are the key properties of 2-pyrrolidin-1-ylpyridine-3,5-diamine;hydrate;dihydrochloride?
2-pyrrolidin-1-ylpyridine-3,5-diamine;hydrate;dihydrochloride has a molecular weight of 269.18 g/mol, XLogP of 0.87, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolidin-1-ylpyridine-3,5-diamine;hydrate;dihydrochloride is sourced from PubChem (CID 21082868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).