C11H18N4O — CID 23064302
[1-(3,5-diamino-2-pyridinyl)piperidin-2-yl]methanol (PubChem CID 23064302) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is [1-(3,5-diamino-2-pyridinyl)piperidin-2-yl]methanol.
| Compound Name | [1-(3,5-diamino-2-pyridinyl)piperidin-2-yl]methanol |
|---|---|
| PubChem CID | 23064302 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | [1-(3,5-diamino-2-pyridinyl)piperidin-2-yl]methanol |
| SMILES | Nc1cnc(N2CCCCC2CO)c(N)c1 |
| InChI | InChI=1S/C11H18N4O/c12-8-5-10(13)11(14-6-8)15-4-2-1-3-9(15)7-16/h5-6,9,16H,1-4,7,12-13H2 |
| InChIKey | AVAUPCLJKLAPEU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |