C9H15N3OS — CID 102767808
[1-(5-amino-1,3-thiazol-2-yl)piperidin-2-yl]methanol (PubChem CID 102767808) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is [1-(5-amino-1,3-thiazol-2-yl)piperidin-2-yl]methanol.
| Compound Name | [1-(5-amino-1,3-thiazol-2-yl)piperidin-2-yl]methanol |
|---|---|
| PubChem CID | 102767808 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | [1-(5-amino-1,3-thiazol-2-yl)piperidin-2-yl]methanol |
| SMILES | Nc1cnc(N2CCCCC2CO)s1 |
| InChI | InChI=1S/C9H15N3OS/c10-8-5-11-9(14-8)12-4-2-1-3-7(12)6-13/h5,7,13H,1-4,6,10H2 |
| InChIKey | SJZAMBIGAQLVFD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |