C12H20N4 — CID 62477029
5-methyl-6-(4-methyl-1,4-diazepan-1-yl)pyridin-3-amine (PubChem CID 62477029) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is 5-methyl-6-(4-methyl-1,4-diazepan-1-yl)pyridin-3-amine.
| Compound Name | 5-methyl-6-(4-methyl-1,4-diazepan-1-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 62477029 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 5-methyl-6-(4-methyl-1,4-diazepan-1-yl)pyridin-3-amine |
| SMILES | Cc1cc(N)cnc1N1CCCN(C)CC1 |
| InChI | InChI=1S/C12H20N4/c1-10-8-11(13)9-14-12(10)16-5-3-4-15(2)6-7-16/h8-9H,3-7,13H2,1-2H3 |
| InChIKey | XJYFXGPPFNXULT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |