C15H21N3O2 — CID 80633319
(E)-3-[5-methyl-6-(4-methyl-1,4-diazepan-1-yl)-3-pyridinyl]prop-2-enoic acid (PubChem CID 80633319) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is (E)-3-[5-methyl-6-(4-methyl-1,4-diazepan-1-yl)-3-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-methyl-6-(4-methyl-1,4-diazepan-1-yl)-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 80633319 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | (E)-3-[5-methyl-6-(4-methyl-1,4-diazepan-1-yl)-3-pyridinyl]prop-2-enoic acid |
| SMILES | Cc1cc(/C=C/C(=O)O)cnc1N1CCCN(C)CC1 |
| InChI | InChI=1S/C15H21N3O2/c1-12-10-13(4-5-14(19)20)11-16-15(12)18-7-3-6-17(2)8-9-18/h4-5,10-11H,3,6-9H2,1-2H3,(H,19,20)/b5-4+ |
| InChIKey | VLNKQKYQDQGDNK-SNAWJCMRSA-N |
| XLogP | 1.63 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|