C16H23N3O2 — CID 80638020
(E)-3-[6-(3-ethyl-4-methylpiperazin-1-yl)-5-methyl-3-pyridinyl]prop-2-enoic acid (PubChem CID 80638020) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is (E)-3-[6-(3-ethyl-4-methylpiperazin-1-yl)-5-methyl-3-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-(3-ethyl-4-methylpiperazin-1-yl)-5-methyl-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 80638020 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | (E)-3-[6-(3-ethyl-4-methylpiperazin-1-yl)-5-methyl-3-pyridinyl]prop-2-enoic acid |
| SMILES | CCC1CN(c2ncc(/C=C/C(=O)O)cc2C)CCN1C |
| InChI | InChI=1S/C16H23N3O2/c1-4-14-11-19(8-7-18(14)3)16-12(2)9-13(10-17-16)5-6-15(20)21/h5-6,9-10,14H,4,7-8,11H2,1-3H3,(H,20,21)/b6-5+ |
| InChIKey | KARHTYYFNFIYIN-AATRIKPKSA-N |
| XLogP | 2.02 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|