C16H22N2O2 — CID 80634012
(E)-3-[6-(4,4-dimethylpiperidin-1-yl)-5-methyl-3-pyridinyl]prop-2-enoic acid (PubChem CID 80634012) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is (E)-3-[6-(4,4-dimethylpiperidin-1-yl)-5-methyl-3-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-(4,4-dimethylpiperidin-1-yl)-5-methyl-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 80634012 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | (E)-3-[6-(4,4-dimethylpiperidin-1-yl)-5-methyl-3-pyridinyl]prop-2-enoic acid |
| SMILES | Cc1cc(/C=C/C(=O)O)cnc1N1CCC(C)(C)CC1 |
| InChI | InChI=1S/C16H22N2O2/c1-12-10-13(4-5-14(19)20)11-17-15(12)18-8-6-16(2,3)7-9-18/h4-5,10-11H,6-9H2,1-3H3,(H,19,20)/b5-4+ |
| InChIKey | JYVHOKHORDTUKS-SNAWJCMRSA-N |
| XLogP | 3.11 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|