C8H10F2N4 — CID 130704965
2-(3,3-difluoropyrrolidin-1-yl)pyrimidin-5-amine (PubChem CID 130704965) has the molecular formula C8H10F2N4 and a molecular weight of 200.19 g/mol. Its IUPAC name is 2-(3,3-difluoropyrrolidin-1-yl)pyrimidin-5-amine.
| Compound Name | 2-(3,3-difluoropyrrolidin-1-yl)pyrimidin-5-amine |
|---|---|
| PubChem CID | 130704965 |
| Molecular Formula | C8H10F2N4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 2-(3,3-difluoropyrrolidin-1-yl)pyrimidin-5-amine |
| SMILES | Nc1cnc(N2CCC(F)(F)C2)nc1 |
| InChI | InChI=1S/C8H10F2N4/c9-8(10)1-2-14(5-8)7-12-3-6(11)4-13-7/h3-4H,1-2,5,11H2 |
| InChIKey | YXURLSXRCNGXSI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |