C13H16F2N2 — CID 168665760
6-(4,4-difluoropiperidin-1-yl)-3-ethenyl-2-methylpyridine (PubChem CID 168665760) has the molecular formula C13H16F2N2 and a molecular weight of 238.28 g/mol. Its IUPAC name is 6-(4,4-difluoropiperidin-1-yl)-3-ethenyl-2-methylpyridine.
| Compound Name | 6-(4,4-difluoropiperidin-1-yl)-3-ethenyl-2-methylpyridine |
|---|---|
| PubChem CID | 168665760 |
| Molecular Formula | C13H16F2N2 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 6-(4,4-difluoropiperidin-1-yl)-3-ethenyl-2-methylpyridine |
| SMILES | C=Cc1ccc(N2CCC(F)(F)CC2)nc1C |
| InChI | InChI=1S/C13H16F2N2/c1-3-11-4-5-12(16-10(11)2)17-8-6-13(14,15)7-9-17/h3-5H,1,6-9H2,2H3 |
| InChIKey | TVVRBCXXGBXIJI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |