C14H20F2N2 — CID 155742359
5-tert-butyl-2-(4,4-difluoropiperidin-1-yl)pyridine (PubChem CID 155742359) has the molecular formula C14H20F2N2 and a molecular weight of 254.32 g/mol. Its IUPAC name is 5-tert-butyl-2-(4,4-difluoropiperidin-1-yl)pyridine.
| Compound Name | 5-tert-butyl-2-(4,4-difluoropiperidin-1-yl)pyridine |
|---|---|
| PubChem CID | 155742359 |
| Molecular Formula | C14H20F2N2 |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 5-tert-butyl-2-(4,4-difluoropiperidin-1-yl)pyridine |
| SMILES | CC(C)(C)c1ccc(N2CCC(F)(F)CC2)nc1 |
| InChI | InChI=1S/C14H20F2N2/c1-13(2,3)11-4-5-12(17-10-11)18-8-6-14(15,16)7-9-18/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | ZHNDFQXSCYQXBT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |