C16H26ClN3 — CID 107875541
1-(5-tert-butyl-2-pyridinyl)-4-(2-chloroethyl)-1,4-diazepane (PubChem CID 107875541) has the molecular formula C16H26ClN3 and a molecular weight of 295.86 g/mol. Its IUPAC name is 1-(5-tert-butyl-2-pyridinyl)-4-(2-chloroethyl)-1,4-diazepane.
| Compound Name | 1-(5-tert-butyl-2-pyridinyl)-4-(2-chloroethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 107875541 |
| Molecular Formula | C16H26ClN3 |
| Molecular Weight | 295.86 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 1-(5-tert-butyl-2-pyridinyl)-4-(2-chloroethyl)-1,4-diazepane |
| SMILES | CC(C)(C)c1ccc(N2CCCN(CCCl)CC2)nc1 |
| InChI | InChI=1S/C16H26ClN3/c1-16(2,3)14-5-6-15(18-13-14)20-9-4-8-19(10-7-17)11-12-20/h5-6,13H,4,7-12H2,1-3H3 |
| InChIKey | GWWNTXXDAQJHFD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.86 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|