C15H22ClN3 — CID 113390959
2-[4-(2-chloroethyl)-1,4-diazepan-1-yl]-6,7-dihydro-5H-cyclopenta[b]pyridine (PubChem CID 113390959) has the molecular formula C15H22ClN3 and a molecular weight of 279.81 g/mol. Its IUPAC name is 2-[4-(2-chloroethyl)-1,4-diazepan-1-yl]-6,7-dihydro-5H-cyclopenta[b]pyridine.
| Compound Name | 2-[4-(2-chloroethyl)-1,4-diazepan-1-yl]-6,7-dihydro-5H-cyclopenta[b]pyridine |
|---|---|
| PubChem CID | 113390959 |
| Molecular Formula | C15H22ClN3 |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-[4-(2-chloroethyl)-1,4-diazepan-1-yl]-6,7-dihydro-5H-cyclopenta[b]pyridine |
| SMILES | ClCCN1CCCN(c2ccc3c(n2)CCC3)CC1 |
| InChI | InChI=1S/C15H22ClN3/c16-7-10-18-8-2-9-19(12-11-18)15-6-5-13-3-1-4-14(13)17-15/h5-6H,1-4,7-12H2 |
| InChIKey | FLQQADKEIVWWQM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|