C13H18ClN5 — CID 113446615
4-[4-(2-chloroethyl)-1,4-diazepan-1-yl]pyrazolo[1,5-a]pyrazine (PubChem CID 113446615) has the molecular formula C13H18ClN5 and a molecular weight of 279.77 g/mol. Its IUPAC name is 4-[4-(2-chloroethyl)-1,4-diazepan-1-yl]pyrazolo[1,5-a]pyrazine.
| Compound Name | 4-[4-(2-chloroethyl)-1,4-diazepan-1-yl]pyrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 113446615 |
| Molecular Formula | C13H18ClN5 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 4-[4-(2-chloroethyl)-1,4-diazepan-1-yl]pyrazolo[1,5-a]pyrazine |
| SMILES | ClCCN1CCCN(c2nccn3nccc23)CC1 |
| InChI | InChI=1S/C13H18ClN5/c14-3-8-17-6-1-7-18(11-10-17)13-12-2-4-16-19(12)9-5-15-13/h2,4-5,9H,1,3,6-8,10-11H2 |
| InChIKey | YTZTYCQPQUNWLC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 36.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|