C14H22N6 — CID 104729861
4-(4-pyrazolo[1,5-a]pyrazin-4-ylpiperazin-1-yl)butan-1-amine (PubChem CID 104729861) has the molecular formula C14H22N6 and a molecular weight of 274.37 g/mol. Its IUPAC name is 4-(4-pyrazolo[1,5-a]pyrazin-4-ylpiperazin-1-yl)butan-1-amine.
| Compound Name | 4-(4-pyrazolo[1,5-a]pyrazin-4-ylpiperazin-1-yl)butan-1-amine |
|---|---|
| PubChem CID | 104729861 |
| Molecular Formula | C14H22N6 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 4-(4-pyrazolo[1,5-a]pyrazin-4-ylpiperazin-1-yl)butan-1-amine |
| SMILES | NCCCCN1CCN(c2nccn3nccc23)CC1 |
| InChI | InChI=1S/C14H22N6/c15-4-1-2-7-18-9-11-19(12-10-18)14-13-3-5-17-20(13)8-6-16-14/h3,5-6,8H,1-2,4,7,9-12,15H2 |
| InChIKey | ZWWZDMWZIQCQPD-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 62.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|