C14H23BrN4 — CID 106875241
4-[4-(3-bromo-4-methyl-2-pyridinyl)piperazin-1-yl]butan-1-amine (PubChem CID 106875241) has the molecular formula C14H23BrN4 and a molecular weight of 327.27 g/mol. Its IUPAC name is 4-[4-(3-bromo-4-methyl-2-pyridinyl)piperazin-1-yl]butan-1-amine.
| Compound Name | 4-[4-(3-bromo-4-methyl-2-pyridinyl)piperazin-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 106875241 |
| Molecular Formula | C14H23BrN4 |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 4-[4-(3-bromo-4-methyl-2-pyridinyl)piperazin-1-yl]butan-1-amine |
| SMILES | Cc1ccnc(N2CCN(CCCCN)CC2)c1Br |
| InChI | InChI=1S/C14H23BrN4/c1-12-4-6-17-14(13(12)15)19-10-8-18(9-11-19)7-3-2-5-16/h4,6H,2-3,5,7-11,16H2,1H3 |
| InChIKey | WYLWFAYNQKLDFO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|